Products 959786-79-9
CAS 959786-79-9 appears in our catalog under these names: Metoprolol–d5, Metoprolol-d5, 96.93%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
1,1,2,3,3-pentadeuterio-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 959786-79-9) is a chemical compound with the molecular formula C15H25NO3 and a molecular weight of 272.39 g/mol. IUPAC name: 1,1,2,3,3-pentadeuterio-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: IUBSYMUCCVWXPE-FIWUMSIFSA-N.
| Molecular formula | C15H25NO3 |
|---|---|
| Molecular weight | 272.39 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuterio-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | IUBSYMUCCVWXPE-FIWUMSIFSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CCOC)O)NC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Metoprolol-d5, orb3138397