Products 129409-54-7
CAS 129409-54-7 appears in our catalog under these names: Ethyl 2-(2,4-difluorophenyl)acetate, 95%, Ethyl 2–(2，4–difluorophenyl)acetate, (2,4-Difluorophenyl)acetic acid ethyl ester, Ethyl 2-(2，4-difluorophenyl)acetate, 95%, 95%, (2,4-Difluorophenyl)acetic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg, 10g.
Ethyl 2-(2,4-difluorophenyl)acetate (CAS 129409-54-7) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: ethyl 2-(2,4-difluorophenyl)acetate. InChIKey: BVGMVGKUWOWKIV-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | ethyl 2-(2,4-difluorophenyl)acetate |
| InChIKey | BVGMVGKUWOWKIV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)