CAS 129432-31-1 is the registry number for N-(2,6-Dichloro-4-methylpyridin-3-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,6-dichloro-4-methyl-3-pyridinyl)acetamide (CAS 129432-31-1) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: N-(2,6-dichloro-4-methyl-3-pyridinyl)acetamide. InChIKey: NXTNEKKDMJJQMR-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | N-(2,6-dichloro-4-methyl-3-pyridinyl)acetamide |
| InChIKey | NXTNEKKDMJJQMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1NC(=O)C)Cl)Cl |
Computed by PubChem (NCBI)