Products 129488-34-2
CAS 129488-34-2 is the registry number for 3,4-Diacetoxycinnamamide. Offered by: MedChemExpress. Available pack sizes: 1 mg.
[2-acetyloxy-4-[(E)-3-amino-3-oxoprop-1-enyl]phenyl] acetate (CAS 129488-34-2) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: [2-acetyloxy-4-[(E)-3-amino-3-oxoprop-1-enyl]phenyl] acetate. InChIKey: DUWHMOBTGPUYEL-GQCTYLIASA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | [2-acetyloxy-4-[(E)-3-amino-3-oxoprop-1-enyl]phenyl] acetate |
| InChIKey | DUWHMOBTGPUYEL-GQCTYLIASA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)/C=C/C(=O)N)OC(=O)C |
Computed by PubChem (NCBI)