CAS 129519-24-0 is the registry number for D-Galacturonic acid benzyl ester. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 250mg, 50mg.
Benzyl (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (CAS 129519-24-0) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: benzyl (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate. InChIKey: WFZOFLXHKAFEDZ-QCNOEVLYSA-N.
| Molecular formula | C13H16O7 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | benzyl (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| InChIKey | WFZOFLXHKAFEDZ-QCNOEVLYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H]([C@@H]([C@@H]([C@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)