Products 129519-24-0

CAS 129519-24-0 is the registry number for D-Galacturonic acid benzyl ester. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Benzyl (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (CAS 129519-24-0) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: benzyl (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate. InChIKey: WFZOFLXHKAFEDZ-QCNOEVLYSA-N.

Identity
Molecular formulaC13H16O7
Molecular weight284.26 g/mol
IUPAC namebenzyl (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate
InChIKeyWFZOFLXHKAFEDZ-QCNOEVLYSA-N
SMILESC1=CC=C(C=C1)COC(=O)[C@H]([C@@H]([C@@H]([C@H](C=O)O)O)O)O

Computed by PubChem (NCBI)