CAS 1296224-97-9 is the registry number for 4-Chloro-thieno(3,2-c)pyridine-2-carboxaldehyde. Offered by: TRC. Available pack sizes: 2,5g.
4-chlorothieno[3,2-c]pyridine-2-carbaldehyde (CAS 1296224-97-9) is a chemical compound with the molecular formula C8H4ClNOS and a molecular weight of 197.64 g/mol. IUPAC name: 4-chlorothieno[3,2-c]pyridine-2-carbaldehyde. InChIKey: WIJJQDFZHFZBSD-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNOS |
|---|---|
| Molecular weight | 197.64 g/mol |
| IUPAC name | 4-chlorothieno[3,2-c]pyridine-2-carbaldehyde |
| InChIKey | WIJJQDFZHFZBSD-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1SC(=C2)C=O)Cl |
Computed by PubChem (NCBI)