CAS 16794-67-5 appears in our catalog under these names: 4-Chlorobenzoyl isothiocyanate, 85%, 4-Chlorobenzoyl isothiocyanate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
4-chlorobenzoyl isothiocyanate (CAS 16794-67-5) is a chemical compound with the molecular formula C8H4ClNOS and a molecular weight of 197.64 g/mol. IUPAC name: 4-chlorobenzoyl isothiocyanate. InChIKey: OTZBZZNWOAIAEN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNOS |
|---|---|
| Molecular weight | 197.64 g/mol |
| IUPAC name | 4-chlorobenzoyl isothiocyanate |
| InChIKey | OTZBZZNWOAIAEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N=C=S)Cl |
Computed by PubChem (NCBI)