CAS 67748-61-2 appears in our catalog under these names: Benzothiazole-2-carbonyl chloride, 95% , BENZOTHIAZOLE-2-CARBONYL CHLORIDE, 95%, 1,3-Benzothiazole-2-carbonyl chloride, 95%, Benzo[d]thiazole-2-carbonyl chloride, 95%,RG, 95%,RG. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
1,3-benzothiazole-2-carbonyl chloride (CAS 67748-61-2) is a chemical compound with the molecular formula C8H4ClNOS and a molecular weight of 197.64 g/mol. IUPAC name: 1,3-benzothiazole-2-carbonyl chloride. InChIKey: AOIGQLLPWDXVGB-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNOS |
|---|---|
| Molecular weight | 197.64 g/mol |
| IUPAC name | 1,3-benzothiazole-2-carbonyl chloride |
| InChIKey | AOIGQLLPWDXVGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)