CAS 80231-47-6 is the registry number for 6-Chlorothieno[2,3-b]pyridine-2-carbaldehyde 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-chlorothieno[2,3-b]pyridine-2-carbaldehyde (CAS 80231-47-6) is a chemical compound with the molecular formula C8H4ClNOS and a molecular weight of 197.64 g/mol. IUPAC name: 6-chlorothieno[2,3-b]pyridine-2-carbaldehyde. InChIKey: FUTYTLQGHKTOLU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNOS |
|---|---|
| Molecular weight | 197.64 g/mol |
| IUPAC name | 6-chlorothieno[2,3-b]pyridine-2-carbaldehyde |
| InChIKey | FUTYTLQGHKTOLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=C(S2)C=O)Cl |
Computed by PubChem (NCBI)