CAS 2920713-53-5 is the registry number for 3-Chlorothieno[2,3-c]pyridine-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chlorothieno[2,3-c]pyridine-4-carbaldehyde (CAS 2920713-53-5) is a chemical compound with the molecular formula C8H4ClNOS and a molecular weight of 197.64 g/mol. IUPAC name: 3-chlorothieno[2,3-c]pyridine-4-carbaldehyde. InChIKey: XOPBEYFEIOOOGG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNOS |
|---|---|
| Molecular weight | 197.64 g/mol |
| IUPAC name | 3-chlorothieno[2,3-c]pyridine-4-carbaldehyde |
| InChIKey | XOPBEYFEIOOOGG-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C=N1)SC=C2Cl)C=O |
Computed by PubChem (NCBI)