CAS 129633-42-7 is the registry number for 1,3-dibromo-2-methoxy-4,5-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-2-methoxy-4,5-dimethylbenzene (CAS 129633-42-7) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 1,3-dibromo-2-methoxy-4,5-dimethylbenzene. InChIKey: PKJLUUIXJFIQPV-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O |
|---|---|
| Molecular weight | 293.98 g/mol |
| IUPAC name | 1,3-dibromo-2-methoxy-4,5-dimethylbenzene |
| InChIKey | PKJLUUIXJFIQPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)Br)OC)Br |
Computed by PubChem (NCBI)