Products 129745-35-3
CAS 129745-35-3 is the registry number for 5’(R)-C-Methyl-5-methyluridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,5R)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 129745-35-3) is a chemical compound with the molecular formula C11H16N2O6 and a molecular weight of 272.25 g/mol. IUPAC name: 1-[(2R,5R)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: CDIMXSCNZIUNDB-HQWXHRIMSA-N.
| Molecular formula | C11H16N2O6 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 1-[(2R,5R)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | CDIMXSCNZIUNDB-HQWXHRIMSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C(C([C@H](O2)C(C)O)O)O |
Computed by PubChem (NCBI)