CAS 129784-88-9 is the registry number for Tryptophan-4,5-Dione. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(4,5-dioxo-1H-indol-3-yl)propanoic acid (CAS 129784-88-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: (2S)-2-amino-3-(4,5-dioxo-1H-indol-3-yl)propanoic acid. InChIKey: NUSQIWNBKCIPCW-LURJTMIESA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(4,5-dioxo-1H-indol-3-yl)propanoic acid |
| InChIKey | NUSQIWNBKCIPCW-LURJTMIESA-N |
| SMILES | C1=CC(=O)C(=O)C2=C1NC=C2C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)