CAS 1298108-45-8 is the registry number for 2'-Bromo-9,9'-spirobi[fluoren]-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2'-bromo-9,9'-spirobi[fluorene]-2-ol (CAS 1298108-45-8) is a chemical compound with the molecular formula C25H15BrO and a molecular weight of 411.3 g/mol. IUPAC name: 2'-bromo-9,9'-spirobi[fluorene]-2-ol. InChIKey: NKJGSHQFTKKFKR-UHFFFAOYSA-N.
| Molecular formula | C25H15BrO |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 2'-bromo-9,9'-spirobi[fluorene]-2-ol |
| InChIKey | NKJGSHQFTKKFKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=C4C=C(C=C6)Br)C=C(C=C3)O |
Computed by PubChem (NCBI)