CAS 1621397-55-4 is the registry number for 3'-Bromospiro[fluorene-9,9'-xanthene]. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
3'-bromospiro[fluorene-9,9'-xanthene] (CAS 1621397-55-4) is a chemical compound with the molecular formula C25H15BrO and a molecular weight of 411.3 g/mol. IUPAC name: 3'-bromospiro[fluorene-9,9'-xanthene]. InChIKey: UBZULIKBHMSKKU-UHFFFAOYSA-N.
| Molecular formula | C25H15BrO |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 3'-bromospiro[fluorene-9,9'-xanthene] |
| InChIKey | UBZULIKBHMSKKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C24C5=C(C=C(C=C5)Br)OC6=CC=CC=C46 |
Computed by PubChem (NCBI)