CAS 1609484-28-7 is the registry number for 3-Bromospiro[9H-fluorene-9,9′-[9H]xanthene], 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
3-bromospiro[fluorene-9,9'-xanthene] (CAS 1609484-28-7) is a chemical compound with the molecular formula C25H15BrO and a molecular weight of 411.3 g/mol. IUPAC name: 3-bromospiro[fluorene-9,9'-xanthene]. InChIKey: DGLBXGSXRRICJF-UHFFFAOYSA-N.
| Molecular formula | C25H15BrO |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 3-bromospiro[fluorene-9,9'-xanthene] |
| InChIKey | DGLBXGSXRRICJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5OC6=CC=CC=C46)C=CC(=C3)Br |
Computed by PubChem (NCBI)