CAS 899422-06-1 appears in our catalog under these names: 2–Bromospiro(9H–fluorene–9,9'–(9H)xanthene), 2-Bromospiro[9H-fluorene-9,9'-[9H]xanthene], >98.0%(GC), 2-Bromospiro[9H-fluorene-9,9'-[9H]xanthene], 97%, 97%, 2-Bromospiro[9H-fluorene-9,9'-[9H]xanthene], 97%, 2-Bromospiro[fluorene-9,9'-xanthene], 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-bromospiro[fluorene-9,9'-xanthene] (CAS 899422-06-1) is a chemical compound with the molecular formula C25H15BrO and a molecular weight of 411.3 g/mol. IUPAC name: 2-bromospiro[fluorene-9,9'-xanthene]. InChIKey: MNBDZJINQUZDFP-UHFFFAOYSA-N.
| Molecular formula | C25H15BrO |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 2-bromospiro[fluorene-9,9'-xanthene] |
| InChIKey | MNBDZJINQUZDFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5OC6=CC=CC=C46)C=C(C=C3)Br |
Computed by PubChem (NCBI)