CAS 1609484-45-8 appears in our catalog under these names: 5-Bromospiro[fluorene-9,9'-xanthene], 95%, 4–Bromospiro(fluorene–9,9'–xanthene), 4-Bromospiro[fluorene-9,9'-xanthene], >98.0%(GC), 4-Bromo-spiro[9H-fluorene-9,9'-[9H]xanthene] 98%, 4-Bromospiro[fluorene-9,9'-xanthene], 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
4-bromospiro[fluorene-9,9'-xanthene] (CAS 1609484-45-8) is a chemical compound with the molecular formula C25H15BrO and a molecular weight of 411.3 g/mol. IUPAC name: 4-bromospiro[fluorene-9,9'-xanthene]. InChIKey: WQAGYCVGNQJYKT-UHFFFAOYSA-N.
| Molecular formula | C25H15BrO |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 4-bromospiro[fluorene-9,9'-xanthene] |
| InChIKey | WQAGYCVGNQJYKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5OC6=CC=CC=C46)C=CC=C3Br |
Computed by PubChem (NCBI)