CAS 129909-71-3 is the registry number for 7-Chloro-6-(2-chloroethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-chloro-6-(2-chloroethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine (CAS 129909-71-3) is a chemical compound with the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. IUPAC name: 7-chloro-6-(2-chloroethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: QMOZCJFFQVTEJV-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3 |
|---|---|
| Molecular weight | 244.12 g/mol |
| IUPAC name | 7-chloro-6-(2-chloroethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | QMOZCJFFQVTEJV-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(C(=C2Cl)CCCl)C |
Computed by PubChem (NCBI)