Products 1628459-96-0
CAS 1628459-96-0 is the registry number for 4,6-Dichloro-1-isopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-3-methyl-1-propan-2-ylpyrazolo[5,4-b]pyridine (CAS 1628459-96-0) is a chemical compound with the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. IUPAC name: 4,6-dichloro-3-methyl-1-propan-2-ylpyrazolo[5,4-b]pyridine. InChIKey: YXHCGZXFEATADG-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3 |
|---|---|
| Molecular weight | 244.12 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-1-propan-2-ylpyrazolo[5,4-b]pyridine |
| InChIKey | YXHCGZXFEATADG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)Cl)Cl)C(C)C |
Computed by PubChem (NCBI)