CAS 1423033-36-6 appears in our catalog under these names: 3-(Chloromethyl)-4-methyl-5-phenyl-4H-1,2,4-triazole hydrochloride, 95%, 3-(Chloromethyl)-4-methyl-5-phenyl-4H-1,2,4-triazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(chloromethyl)-4-methyl-5-phenyl-1,2,4-triazole;hydrochloride (CAS 1423033-36-6) is a chemical compound with the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. IUPAC name: 3-(chloromethyl)-4-methyl-5-phenyl-1,2,4-triazole;hydrochloride. InChIKey: IJKIRRBKQPCNHG-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3 |
|---|---|
| Molecular weight | 244.12 g/mol |
| IUPAC name | 3-(chloromethyl)-4-methyl-5-phenyl-1,2,4-triazole;hydrochloride |
| InChIKey | IJKIRRBKQPCNHG-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1C2=CC=CC=C2)CCl.Cl |
Computed by PubChem (NCBI)