CAS 2230713-97-8 is the registry number for 2,4-Dichloro-7-isobutyl-7H-pyrrolo[2,3-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine (CAS 2230713-97-8) is a chemical compound with the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. IUPAC name: 2,4-dichloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine. InChIKey: RACIVLQNXYBBGR-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3 |
|---|---|
| Molecular weight | 244.12 g/mol |
| IUPAC name | 2,4-dichloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine |
| InChIKey | RACIVLQNXYBBGR-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=CC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)