CAS 1375303-12-0 is the registry number for 5-Butyl-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-butyl-2,4-dichloropyrrolo[3,2-d]pyrimidine (CAS 1375303-12-0) is a chemical compound with the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. IUPAC name: 5-butyl-2,4-dichloropyrrolo[3,2-d]pyrimidine. InChIKey: KPNLHIMFAFTTNO-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3 |
|---|---|
| Molecular weight | 244.12 g/mol |
| IUPAC name | 5-butyl-2,4-dichloropyrrolo[3,2-d]pyrimidine |
| InChIKey | KPNLHIMFAFTTNO-UHFFFAOYSA-N |
| SMILES | CCCCN1C=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)