CAS 129911-96-2 is the registry number for 6-AMINO-8-METHYL-3,4-DIHYDROQUINOLIN-2(1H)-ONE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
6-amino-8-methyl-3,4-dihydro-1H-quinolin-2-one (CAS 129911-96-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 6-amino-8-methyl-3,4-dihydro-1H-quinolin-2-one. InChIKey: BLDNVMJWCHPBCM-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-amino-8-methyl-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | BLDNVMJWCHPBCM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)CC2)N |
Computed by PubChem (NCBI)