CAS 1300028-94-7 appears in our catalog under these names: N-([1,1'-Biphenyl]-4-yl)dibenzo[b,d]furan-2-amine, N-([1,1'-Biphenyl]-4-yl)dibenzo[b,d]furan-2-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
N-(4-phenylphenyl)dibenzofuran-2-amine (CAS 1300028-94-7) is a chemical compound with the molecular formula C24H17NO and a molecular weight of 335.4 g/mol. IUPAC name: N-(4-phenylphenyl)dibenzofuran-2-amine. InChIKey: GOHKEMJXFBPCBO-UHFFFAOYSA-N.
| Molecular formula | C24H17NO |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | N-(4-phenylphenyl)dibenzofuran-2-amine |
| InChIKey | GOHKEMJXFBPCBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC4=C(C=C3)OC5=CC=CC=C54 |
Computed by PubChem (NCBI)