Products 1318338-47-4

CAS 1318338-47-4 is the registry number for N-([1,1'-biphenyl]-4-yl)dibenzo[b,d]furan-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

N-(4-phenylphenyl)dibenzofuran-4-amine (CAS 1318338-47-4) is a chemical compound with the molecular formula C24H17NO and a molecular weight of 335.4 g/mol. IUPAC name: N-(4-phenylphenyl)dibenzofuran-4-amine. InChIKey: GYQUYJZZRACXQE-UHFFFAOYSA-N.

Identity
Molecular formulaC24H17NO
Molecular weight335.4 g/mol
IUPAC nameN-(4-phenylphenyl)dibenzofuran-4-amine
InChIKeyGYQUYJZZRACXQE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=CC4=C3OC5=CC=CC=C45

Computed by PubChem (NCBI)