Products 896427-53-5
CAS 896427-53-5 is the registry number for 4'-(9H-Carbazol-9-yl)-[1,1'-biphenyl]-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-carbazol-9-ylphenyl)phenol (CAS 896427-53-5) is a chemical compound with the molecular formula C24H17NO and a molecular weight of 335.4 g/mol. IUPAC name: 4-(4-carbazol-9-ylphenyl)phenol. InChIKey: LFGQKWXDPSVSJC-UHFFFAOYSA-N.
| Molecular formula | C24H17NO |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-(4-carbazol-9-ylphenyl)phenol |
| InChIKey | LFGQKWXDPSVSJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)