Products 13006-69-4
CAS 13006-69-4 is the registry number for Lincosamine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4S,5R,6R)-6-[(1R,2R)-1-amino-2-hydroxypropyl]oxane-2,3,4,5-tetrol (CAS 13006-69-4) is a chemical compound with the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. IUPAC name: (3R,4S,5R,6R)-6-[(1R,2R)-1-amino-2-hydroxypropyl]oxane-2,3,4,5-tetrol. InChIKey: KOFBVFFPLADGGO-DUSUDKPKSA-N.
| Molecular formula | C8H17NO6 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (3R,4S,5R,6R)-6-[(1R,2R)-1-amino-2-hydroxypropyl]oxane-2,3,4,5-tetrol |
| InChIKey | KOFBVFFPLADGGO-DUSUDKPKSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O)N)O |
Computed by PubChem (NCBI)