CAS 142345-67-3 is the registry number for 6-Deoxy-6-((2-Hydroxyethyl)amino)-beta-L-Sorbofuranose HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S,5S)-5-[(2-hydroxyethylamino)methyl]-2-(hydroxymethyl)oxolane-2,3,4-triol (CAS 142345-67-3) is a chemical compound with the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. IUPAC name: (2R,3S,4S,5S)-5-[(2-hydroxyethylamino)methyl]-2-(hydroxymethyl)oxolane-2,3,4-triol. InChIKey: CETNPEDCXLNCLP-FKSUSPILSA-N.
| Molecular formula | C8H17NO6 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R,3S,4S,5S)-5-[(2-hydroxyethylamino)methyl]-2-(hydroxymethyl)oxolane-2,3,4-triol |
| InChIKey | CETNPEDCXLNCLP-FKSUSPILSA-N |
| SMILES | C(CO)NC[C@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O |
Computed by PubChem (NCBI)