CAS 214836-06-3 is the registry number for N-Methoxy-N-methyl-beta-D-glucopyranosylamine. Offered by: TRC. Available pack sizes: 500mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(methyl)amino]oxane-3,4,5-triol (CAS 214836-06-3) is a chemical compound with the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(methyl)amino]oxane-3,4,5-triol. InChIKey: CEYYBXHCZIZBGB-JAJWTYFOSA-N.
| Molecular formula | C8H17NO6 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(methyl)amino]oxane-3,4,5-triol |
| InChIKey | CEYYBXHCZIZBGB-JAJWTYFOSA-N |
| SMILES | CN([C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC |
Computed by PubChem (NCBI)