CAS 350230-37-4 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-3-hydroxypropanoic acid hydrate, 97%, (R)-2-((tert-Butoxycarbonyl)amino)-3-hydroxypropanoic acid hydrate, 97% ,, 97% ,. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 100g, 5g, 10g.
(2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrate (CAS 350230-37-4) is a chemical compound with the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. IUPAC name: (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrate. InChIKey: JLIWGTMHYWJUPM-NUBCRITNSA-N.
| Molecular formula | C8H17NO6 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrate |
| InChIKey | JLIWGTMHYWJUPM-NUBCRITNSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(=O)O.O |
Computed by PubChem (NCBI)