CAS 204191-40-2 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-hydroxypropanoic acid hydrate, 98%, Boc–Ser–OH·H2O, Boc-Ser-OH Hydrate 98%, (S)-2-((tert-Butoxycarbonyl)amino)-3-hydroxypropanoic acid hydrate, (Tert-butoxycarbonyl)-L-serine hydrate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 1kg, 5g, 25g.
(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrate (CAS 204191-40-2) is a chemical compound with the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. IUPAC name: (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrate. InChIKey: JLIWGTMHYWJUPM-JEDNCBNOSA-N.
| Molecular formula | C8H17NO6 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrate |
| InChIKey | JLIWGTMHYWJUPM-JEDNCBNOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)O.O |
Computed by PubChem (NCBI)