CAS 130105-46-3 is the registry number for 2,​3-​Dihydro-​benzo(b)​thiophene-​3-​acetic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)acetic acid (CAS 130105-46-3) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: 2-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)acetic acid. InChIKey: SKXBVWGGQFGPID-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)acetic acid |
| InChIKey | SKXBVWGGQFGPID-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2S1(=O)=O)CC(=O)O |
Computed by PubChem (NCBI)