Products 130105-46-3

CAS 130105-46-3 is the registry number for 2,​3-​Dihydro-​benzo(b)​thiophene-​3-​acetic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)acetic acid (CAS 130105-46-3) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: 2-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)acetic acid. InChIKey: SKXBVWGGQFGPID-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O4S
Molecular weight226.25 g/mol
IUPAC name2-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)acetic acid
InChIKeySKXBVWGGQFGPID-UHFFFAOYSA-N
SMILESC1C(C2=CC=CC=C2S1(=O)=O)CC(=O)O

Computed by PubChem (NCBI)