Products 1301739-86-5
CAS 1301739-86-5 appears in our catalog under these names: Fmoc-ANBA, 5-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-nitrobenzoic acid, 97%. Offered by: Creative Peptides, Chemat Brand. Available pack sizes: 5g, 25g, on request.
5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoic acid (CAS 1301739-86-5) is a chemical compound with the molecular formula C22H16N2O6 and a molecular weight of 404.4 g/mol. IUPAC name: 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoic acid. InChIKey: CBLLUZHKDVNVCV-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O6 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoic acid |
| InChIKey | CBLLUZHKDVNVCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=C(C=C4)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)