Products 212118-80-4

CAS 212118-80-4 is the registry number for 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-nitrobenzoic acid (CAS 212118-80-4) is a chemical compound with the molecular formula C22H16N2O6 and a molecular weight of 404.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-nitrobenzoic acid. InChIKey: KTGPLIBFJZWMLK-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16N2O6
Molecular weight404.4 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-nitrobenzoic acid
InChIKeyKTGPLIBFJZWMLK-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=CC(=C4)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)