Products 632286-84-1
CAS 632286-84-1 is the registry number for 2,2'-(1,4-Dioxo-3,6-diphenylpyrrolo[3,4-c]pyrrole-2,5(1h,4h)-diyl)diacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
2-[5-(carboxymethyl)-3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid (CAS 632286-84-1) is a chemical compound with the molecular formula C22H16N2O6 and a molecular weight of 404.4 g/mol. IUPAC name: 2-[5-(carboxymethyl)-3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid. InChIKey: KOWRWVZFXQEPIL-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O6 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 2-[5-(carboxymethyl)-3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid |
| InChIKey | KOWRWVZFXQEPIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C(=C(N(C3=O)CC(=O)O)C4=CC=CC=C4)C(=O)N2CC(=O)O |
Computed by PubChem (NCBI)