Products 136091-82-2
CAS 136091-82-2 is the registry number for 5-(Aminoacetamido)fluorescein, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetamide (CAS 136091-82-2) is a chemical compound with the molecular formula C22H16N2O6 and a molecular weight of 404.4 g/mol. IUPAC name: 2-amino-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetamide. InChIKey: WKGFWVPSZSRWKS-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O6 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 2-amino-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetamide |
| InChIKey | WKGFWVPSZSRWKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)CN)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)