Products 1341459-60-6

CAS 1341459-60-6 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-nitrobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-nitrobenzoic acid (CAS 1341459-60-6) is a chemical compound with the molecular formula C22H16N2O6 and a molecular weight of 404.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-nitrobenzoic acid. InChIKey: DNOXHJIFYLQSSR-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16N2O6
Molecular weight404.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-nitrobenzoic acid
InChIKeyDNOXHJIFYLQSSR-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)