Products 130312-40-2

CAS 130312-40-2 appears in our catalog under these names: Methyl 4-amino-5-chloro-2-methoxybenzoate hydrochloride, Methyl 4-amino-5-chloro-2-methoxybenzoate hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride (CAS 130312-40-2) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: methyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride. InChIKey: KUFDIVILMYFZOU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11Cl2NO3
Molecular weight252.09 g/mol
IUPAC namemethyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride
InChIKeyKUFDIVILMYFZOU-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)OC)Cl)N.Cl

Computed by PubChem (NCBI)