CAS 130312-40-2 appears in our catalog under these names: Methyl 4-amino-5-chloro-2-methoxybenzoate hydrochloride, Methyl 4-amino-5-chloro-2-methoxybenzoate hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g, 250mg, 5g.
Methyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride (CAS 130312-40-2) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: methyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride. InChIKey: KUFDIVILMYFZOU-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | methyl 4-amino-5-chloro-2-methoxybenzoate;hydrochloride |
| InChIKey | KUFDIVILMYFZOU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)Cl)N.Cl |
Computed by PubChem (NCBI)