Products 1951445-00-3

CAS 1951445-00-3 is the registry number for 5-Amino-4-chloro-2-methoxy-benzoic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-amino-4-chloro-2-methoxybenzoate;hydrochloride (CAS 1951445-00-3) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: methyl 5-amino-4-chloro-2-methoxybenzoate;hydrochloride. InChIKey: KZTBHLRIQCCCJL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11Cl2NO3
Molecular weight252.09 g/mol
IUPAC namemethyl 5-amino-4-chloro-2-methoxybenzoate;hydrochloride
InChIKeyKZTBHLRIQCCCJL-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)OC)N)Cl.Cl

Computed by PubChem (NCBI)