CAS 1951445-00-3 is the registry number for 5-Amino-4-chloro-2-methoxy-benzoic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 5-amino-4-chloro-2-methoxybenzoate;hydrochloride (CAS 1951445-00-3) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: methyl 5-amino-4-chloro-2-methoxybenzoate;hydrochloride. InChIKey: KZTBHLRIQCCCJL-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | methyl 5-amino-4-chloro-2-methoxybenzoate;hydrochloride |
| InChIKey | KZTBHLRIQCCCJL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)N)Cl.Cl |
Computed by PubChem (NCBI)