Products 2228823-04-7
CAS 2228823-04-7 is the registry number for Methyl 3-amino-2-chloro-5-methoxybenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-amino-2-chloro-5-methoxybenzoate;hydrochloride (CAS 2228823-04-7) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: methyl 3-amino-2-chloro-5-methoxybenzoate;hydrochloride. InChIKey: VQLGACSVJDGFPX-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | methyl 3-amino-2-chloro-5-methoxybenzoate;hydrochloride |
| InChIKey | VQLGACSVJDGFPX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)N)Cl)C(=O)OC.Cl |
Computed by PubChem (NCBI)