CAS 82924-41-2 is the registry number for 5-Chloroindoline-2-carboxylic acid hydrochloride hydrate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrate;hydrochloride (CAS 82924-41-2) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrate;hydrochloride. InChIKey: ILYPZNQCOGPZNP-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrate;hydrochloride |
| InChIKey | ILYPZNQCOGPZNP-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=C(C=C2)Cl)C(=O)O.O.Cl |
Computed by PubChem (NCBI)