Products 82924-41-2

CAS 82924-41-2 is the registry number for 5-Chloroindoline-2-carboxylic acid hydrochloride hydrate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrate;hydrochloride (CAS 82924-41-2) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrate;hydrochloride. InChIKey: ILYPZNQCOGPZNP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11Cl2NO3
Molecular weight252.09 g/mol
IUPAC name5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrate;hydrochloride
InChIKeyILYPZNQCOGPZNP-UHFFFAOYSA-N
SMILESC1C(NC2=C1C=C(C=C2)Cl)C(=O)O.O.Cl

Computed by PubChem (NCBI)