Products 130368-69-3
CAS 130368-69-3 appears in our catalog under these names: (R)-2-(Tosyloxy)propanoic acid, 98%, (2R)-2-[[(4-Methylphenyl)sulfonyl]oxy]propanoic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(4-methylphenyl)sulfonyloxypropanoic acid (CAS 130368-69-3) is a chemical compound with the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. IUPAC name: (2R)-2-(4-methylphenyl)sulfonyloxypropanoic acid. InChIKey: QXYOROBKCZWFKK-MRVPVSSYSA-N.
| Molecular formula | C10H12O5S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | (2R)-2-(4-methylphenyl)sulfonyloxypropanoic acid |
| InChIKey | QXYOROBKCZWFKK-MRVPVSSYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H](C)C(=O)O |
Computed by PubChem (NCBI)