CAS 1303968-41-3 appears in our catalog under these names: (4-(Trifluoromethyl)pyridin-2-yl)methanamine dihydrochloride, 95%, (4-(Trifluoromethyl)pyridin-2-yl)methanamine dihydrochloride, 98%, (4-(Trifluoromethyl)pyridin-2-yl)methanamine dihydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg.
[4-(trifluoromethyl)-2-pyridinyl]methanamine;dihydrochloride (CAS 1303968-41-3) is a chemical compound with the molecular formula C7H9Cl2F3N2 and a molecular weight of 249.06 g/mol. IUPAC name: [4-(trifluoromethyl)-2-pyridinyl]methanamine;dihydrochloride. InChIKey: YSPLBTPWLDROMH-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | [4-(trifluoromethyl)-2-pyridinyl]methanamine;dihydrochloride |
| InChIKey | YSPLBTPWLDROMH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(F)(F)F)CN.Cl.Cl |
Computed by PubChem (NCBI)