CAS 2153472-94-5 appears in our catalog under these names: 2,2,2-Trifluoro-1-(pyridin-4-yl)ethanamine dihydrochloride, 95%, 2,2,2–Trifluoro–1–(pyridin–4–yl)ethanamine dihydrochloride, 2,2,2-Trifluoro-1-(pyridin-4-yl)ethanamine dihydrochloride 95%, 2,2,2-Trifluoro-1-(pyridin-4-yl)ethanamine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,2,2-trifluoro-1-pyridin-4-ylethanamine;dihydrochloride (CAS 2153472-94-5) is a chemical compound with the molecular formula C7H9Cl2F3N2 and a molecular weight of 249.06 g/mol. IUPAC name: 2,2,2-trifluoro-1-pyridin-4-ylethanamine;dihydrochloride. InChIKey: GUOGYWOVINNATR-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-pyridin-4-ylethanamine;dihydrochloride |
| InChIKey | GUOGYWOVINNATR-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)