CAS 132915-78-7 appears in our catalog under these names: 4-(Trifluoromethyl)benzene-1,2-diamine dihydrochloride, 95%, 4-(Trifluoromethyl)benzene-1,2-diamine dihydrochloride, 98+%, 4–(Trifluoromethyl)benzene–1,2–diamine dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-(trifluoromethyl)benzene-1,2-diamine;dihydrochloride (CAS 132915-78-7) is a chemical compound with the molecular formula C7H9Cl2F3N2 and a molecular weight of 249.06 g/mol. IUPAC name: 4-(trifluoromethyl)benzene-1,2-diamine;dihydrochloride. InChIKey: YJBDPLWGMGSBMD-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzene-1,2-diamine;dihydrochloride |
| InChIKey | YJBDPLWGMGSBMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)N.Cl.Cl |
Computed by PubChem (NCBI)