CAS 1332529-79-9 is the registry number for C-(5-Trifluoromethyl-pyridin-3-yl)-methylaminedihydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
[5-(trifluoromethyl)-3-pyridinyl]methanamine;dihydrochloride (CAS 1332529-79-9) is a chemical compound with the molecular formula C7H9Cl2F3N2 and a molecular weight of 249.06 g/mol. IUPAC name: [5-(trifluoromethyl)-3-pyridinyl]methanamine;dihydrochloride. InChIKey: XRJFAOSMGPIFLC-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | [5-(trifluoromethyl)-3-pyridinyl]methanamine;dihydrochloride |
| InChIKey | XRJFAOSMGPIFLC-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1C(F)(F)F)CN.Cl.Cl |
Computed by PubChem (NCBI)