CAS 1334509-87-3 appears in our catalog under these names: (R)-2,2,2-Trifluoro-1-(pyridin-2-yl)ethanamine dihydrochloride, 95%, (R)-2,2,2-Trifluoro-1-(pyridin-2-yl)ethanamine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(1R)-2,2,2-trifluoro-1-pyridin-2-ylethanamine;dihydrochloride (CAS 1334509-87-3) is a chemical compound with the molecular formula C7H9Cl2F3N2 and a molecular weight of 249.06 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-pyridin-2-ylethanamine;dihydrochloride. InChIKey: FRNNRJQVLJOGHV-QYCVXMPOSA-N.
| Molecular formula | C7H9Cl2F3N2 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-pyridin-2-ylethanamine;dihydrochloride |
| InChIKey | FRNNRJQVLJOGHV-QYCVXMPOSA-N |
| SMILES | C1=CC=NC(=C1)[C@H](C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)