CAS 13041-60-6 appears in our catalog under these names: Methyl 3–Methoxy–2–naphthoate, Methyl 3-Methoxy-2-naphthoate, >98.0%(GC), Methyl 3-methoxy-2-naphthoate 96%, Methyl 3-methoxy-2-naphthoate, 96%, 96%, methyl 3-methoxy-2-naphthoate, 96%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg.
Methyl 3-methoxynaphthalene-2-carboxylate (CAS 13041-60-6) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: methyl 3-methoxynaphthalene-2-carboxylate. InChIKey: MPLSAOVNAXJHHI-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | methyl 3-methoxynaphthalene-2-carboxylate |
| InChIKey | MPLSAOVNAXJHHI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C=C1C(=O)OC |
Computed by PubChem (NCBI)