CAS 3297-72-1 appears in our catalog under these names: 1–Phenylisoquinoline, 1-Phenylisoquinoline, 98%, 1-Phenylisoquinoline 98%, 1-Phenylisoquinoline, 95%, 1-Phenylisoquinoline, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 10g, 100mg.
1-phenylisoquinoline (CAS 3297-72-1) is a chemical compound with the molecular formula C15H11N and a molecular weight of 205.25 g/mol. IUPAC name: 1-phenylisoquinoline. InChIKey: LPCWDYWZIWDTCV-UHFFFAOYSA-N.
| Molecular formula | C15H11N |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-phenylisoquinoline |
| InChIKey | LPCWDYWZIWDTCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)